C21H26Cl2N4 — CID 123855480
4,6-dichloro-14-ethyl-8-methyl-11-piperazin-1-yl-1,15-diazatricyclo[10.4.0.02,7]hexadeca-2(7),3,5,10,12,15-hexaene (PubChem CID 123855480) has the molecular formula C21H26Cl2N4 and a molecular weight of 405.37 g/mol. Its IUPAC name is 4,6-dichloro-14-ethyl-8-methyl-11-piperazin-1-yl-1,15-diazatricyclo[10.4.0.02,7]hexadeca-2(7),3,5,10,12,15-hexaene.
| Compound Name | 4,6-dichloro-14-ethyl-8-methyl-11-piperazin-1-yl-1,15-diazatricyclo[10.4.0.02,7]hexadeca-2(7),3,5,10,12,15-hexaene |
|---|---|
| PubChem CID | 123855480 |
| Molecular Formula | C21H26Cl2N4 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4,6-dichloro-14-ethyl-8-methyl-11-piperazin-1-yl-1,15-diazatricyclo[10.4.0.02,7]hexadeca-2(7),3,5,10,12,15-hexaene |
| SMILES | CCC1C=C2C(N3CCNCC3)=CCC(C)c3c(Cl)cc(Cl)cc3N2C=N1 |
| InChI | InChI=1S/C21H26Cl2N4/c1-3-16-12-19-18(26-8-6-24-7-9-26)5-4-14(2)21-17(23)10-15(22)11-20(21)27(19)13-25-16/h5,10-14,16,24H,3-4,6-9H2,1-2H3 |
| InChIKey | PYJWYJMTPYNFEM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |