C38H46N2O4 — CID 123856299
(E)-1-(4-tert-butylphenyl)-4-[[4-[5-(4-heptoxyphenyl)-1H-imidazol-2-yl]phenyl]methyl]-5,5-dihydroxypent-3-en-1-one (PubChem CID 123856299) has the molecular formula C38H46N2O4 and a molecular weight of 594.80 g/mol. Its IUPAC name is (E)-1-(4-tert-butylphenyl)-4-[[4-[5-(4-heptoxyphenyl)-1H-imidazol-2-yl]phenyl]methyl]-5,5-dihydroxypent-3-en-1-one.
| Compound Name | (E)-1-(4-tert-butylphenyl)-4-[[4-[5-(4-heptoxyphenyl)-1H-imidazol-2-yl]phenyl]methyl]-5,5-dihydroxypent-3-en-1-one |
|---|---|
| PubChem CID | 123856299 |
| Molecular Formula | C38H46N2O4 |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | (E)-1-(4-tert-butylphenyl)-4-[[4-[5-(4-heptoxyphenyl)-1H-imidazol-2-yl]phenyl]methyl]-5,5-dihydroxypent-3-en-1-one |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C/C(=C\CC(=O)c4ccc(C(C)(C)C)cc4)C(O)O)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C38H46N2O4/c1-5-6-7-8-9-24-44-33-21-16-28(17-22-33)34-26-39-36(40-34)30-12-10-27(11-13-30)25-31(37(42)43)18-23-35(41)29-14-19-32(20-15-29)38(2,3)4/h10-22,26,37,42-43H,5-9,23-25H2,1-4H3,(H,39,40)/b31-18+ |
| InChIKey | LVZAMVMHKYVDFN-FDAWAROLSA-N |
| XLogP | 8.44 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|