C18H26N3+3 — CID 123856563
1,2,3,7,8,9,10-heptamethyl-7,8-dihydropyrido[2,3-b][1,8]naphthyridine-1,9,10-triium (PubChem CID 123856563) has the molecular formula C18H26N3+3 and a molecular weight of 284.43 g/mol. Its IUPAC name is 1,2,3,7,8,9,10-heptamethyl-7,8-dihydropyrido[2,3-b][1,8]naphthyridine-1,9,10-triium.
| Compound Name | 1,2,3,7,8,9,10-heptamethyl-7,8-dihydropyrido[2,3-b][1,8]naphthyridine-1,9,10-triium |
|---|---|
| PubChem CID | 123856563 |
| Molecular Formula | C18H26N3+3 |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 1,2,3,7,8,9,10-heptamethyl-7,8-dihydropyrido[2,3-b][1,8]naphthyridine-1,9,10-triium |
| SMILES | Cc1cc2cc3c([n+](C)c2[n+](C)c1C)=[N+](C)C(C)C(C)C=3 |
| InChI | InChI=1S/C18H26N3/c1-11-8-15-10-16-9-12(2)14(4)20(6)18(16)21(7)17(15)19(5)13(11)3/h8-11,13H,1-7H3/q+3 |
| InChIKey | VFAZPHDHTWZHHK-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 10.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|