C44H72FNO3 — CID 123856588
4-[1-butyl-3a-[(4-hydroxy-4-methylpentyl)amino]-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]-1-(fluoromethyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 123856588) has the molecular formula C44H72FNO3 and a molecular weight of 682.06 g/mol. Its IUPAC name is 4-[1-butyl-3a-[(4-hydroxy-4-methylpentyl)amino]-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]-1-(fluoromethyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 4-[1-butyl-3a-[(4-hydroxy-4-methylpentyl)amino]-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]-1-(fluoromethyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 123856588 |
| Molecular Formula | C44H72FNO3 |
| Molecular Weight | 682.06 g/mol |
| Exact Mass | 681.55 |
| IUPAC Name | 4-[1-butyl-3a-[(4-hydroxy-4-methylpentyl)amino]-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]-1-(fluoromethyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCCC1CCC2(NCCCC(C)(C)O)CCC3(C)C(CCC4C5(C)CC=C(C6=CCC(CF)(C(=O)O)CC6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C44H72FNO3/c1-9-10-12-31-17-25-44(46-28-11-20-38(2,3)49)27-26-41(7)33(36(31)44)13-14-35-40(6)21-18-32(39(4,5)34(40)19-22-42(35,41)8)30-15-23-43(29-45,24-16-30)37(47)48/h15,18,31,33-36,46,49H,9-14,16-17,19-29H2,1-8H3,(H,47,48) |
| InChIKey | QBYQCMKBZGIDEY-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.06 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|