C14H26NO+ — CID 123856754
2-[5-(1-methylpiperidin-1-ium-1-yl)cyclohex-3-en-1-yl]ethanol (PubChem CID 123856754) has the molecular formula C14H26NO+ and a molecular weight of 224.37 g/mol. Its IUPAC name is 2-[5-(1-methylpiperidin-1-ium-1-yl)cyclohex-3-en-1-yl]ethanol.
| Compound Name | 2-[5-(1-methylpiperidin-1-ium-1-yl)cyclohex-3-en-1-yl]ethanol |
|---|---|
| PubChem CID | 123856754 |
| Molecular Formula | C14H26NO+ |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 2-[5-(1-methylpiperidin-1-ium-1-yl)cyclohex-3-en-1-yl]ethanol |
| SMILES | C[N+]1(C2C=CCC(CCO)C2)CCCCC1 |
| InChI | InChI=1S/C14H26NO/c1-15(9-3-2-4-10-15)14-7-5-6-13(12-14)8-11-16/h5,7,13-14,16H,2-4,6,8-12H2,1H3/q+1 |
| InChIKey | UDHIAJFLBPWKDD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|