C21H23N3O2 — CID 123857226
1-[3-(3-ethoxyphenyl)pyrazolo[1,5-a]pyrimidin-5-yl]-3-methyl-2-methylidenepentan-1-one (PubChem CID 123857226) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 1-[3-(3-ethoxyphenyl)pyrazolo[1,5-a]pyrimidin-5-yl]-3-methyl-2-methylidenepentan-1-one.
| Compound Name | 1-[3-(3-ethoxyphenyl)pyrazolo[1,5-a]pyrimidin-5-yl]-3-methyl-2-methylidenepentan-1-one |
|---|---|
| PubChem CID | 123857226 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-[3-(3-ethoxyphenyl)pyrazolo[1,5-a]pyrimidin-5-yl]-3-methyl-2-methylidenepentan-1-one |
| SMILES | C=C(C(=O)c1ccn2ncc(-c3cccc(OCC)c3)c2n1)C(C)CC |
| InChI | InChI=1S/C21H23N3O2/c1-5-14(3)15(4)20(25)19-10-11-24-21(23-19)18(13-22-24)16-8-7-9-17(12-16)26-6-2/h7-14H,4-6H2,1-3H3 |
| InChIKey | NNGXSLDCTJRSSI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|