C25H43NO4 — CID 123857346
2-[1-[4-(2,4-dimethylhexan-3-yl)phenoxy]ethoxy]ethyl N-hexylcarbamate (PubChem CID 123857346) has the molecular formula C25H43NO4 and a molecular weight of 421.62 g/mol. Its IUPAC name is 2-[1-[4-(2,4-dimethylhexan-3-yl)phenoxy]ethoxy]ethyl N-hexylcarbamate.
| Compound Name | 2-[1-[4-(2,4-dimethylhexan-3-yl)phenoxy]ethoxy]ethyl N-hexylcarbamate |
|---|---|
| PubChem CID | 123857346 |
| Molecular Formula | C25H43NO4 |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | 2-[1-[4-(2,4-dimethylhexan-3-yl)phenoxy]ethoxy]ethyl N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)OCCOC(C)Oc1ccc(C(C(C)C)C(C)CC)cc1 |
| InChI | InChI=1S/C25H43NO4/c1-7-9-10-11-16-26-25(27)29-18-17-28-21(6)30-23-14-12-22(13-15-23)24(19(3)4)20(5)8-2/h12-15,19-21,24H,7-11,16-18H2,1-6H3,(H,26,27) |
| InChIKey | QAUFDKNZQGYCQU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|