C33H27N3O2 — CID 123857505
1-(1,1-diphenylhepta-2,4,6-trienyl)-3-(2-methyl-4-pyridinyl)indazole-5-carboxylic acid (PubChem CID 123857505) has the molecular formula C33H27N3O2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 1-(1,1-diphenylhepta-2,4,6-trienyl)-3-(2-methyl-4-pyridinyl)indazole-5-carboxylic acid.
| Compound Name | 1-(1,1-diphenylhepta-2,4,6-trienyl)-3-(2-methyl-4-pyridinyl)indazole-5-carboxylic acid |
|---|---|
| PubChem CID | 123857505 |
| Molecular Formula | C33H27N3O2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 1-(1,1-diphenylhepta-2,4,6-trienyl)-3-(2-methyl-4-pyridinyl)indazole-5-carboxylic acid |
| SMILES | C=CC=CC=CC(c1ccccc1)(c1ccccc1)n1nc(-c2ccnc(C)c2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C33H27N3O2/c1-3-4-5-12-20-33(27-13-8-6-9-14-27,28-15-10-7-11-16-28)36-30-18-17-26(32(37)38)23-29(30)31(35-36)25-19-21-34-24(2)22-25/h3-23H,1H2,2H3,(H,37,38) |
| InChIKey | UFRMFXBWAWZZQC-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|