About 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene
1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene (PubChem CID 123857677) has the molecular formula C20H34O2
and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene |
| PubChem CID | 123857677 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene |
| SMILES | CCC(C)C1=CC=C(OC(C)OCCC2CCCCC2)CC1 |
| InChI | InChI=1S/C20H34O2/c1-4-16(2)19-10-12-20(13-11-19)22-17(3)21-15-14-18-8-6-5-7-9-18/h10,12,16-18H,4-9,11,13-15H2,1-3H3 |
| InChIKey | LAVFYQADXMGOSG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene?
The IUPAC name of 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene (CID 123857677) is 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene.
What is the SMILES notation for 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene?
The canonical SMILES for 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene is CCC(C)C1=CC=C(OC(C)OCCC2CCCCC2)CC1.
What is the InChIKey of 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene?
The InChIKey is LAVFYQADXMGOSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O2/c1-4-16(2)19-10-12-20(13-11-19)22-17(3)21-15-14-18-8-6-5-7-9-18/h10,12,16-18H,4-9,11,13-15H2,1-3H3.
What are the key properties of 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene?
1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene has a molecular weight of 306.49 g/mol, XLogP of 5.99, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-4-[1-(2-cyclohexylethoxy)ethoxy]cyclohexa-1,3-diene is sourced from PubChem (CID 123857677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).