C40H56O14 — CID 123857934
1-(4-acetyloxy-7-ethenyl-5-methyldeca-7,9-dienyl)-6-(6,10-dimethyltetradeca-4,10,12-trienoyloxy)-4,7-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 123857934) has the molecular formula C40H56O14 and a molecular weight of 760.87 g/mol. Its IUPAC name is 1-(4-acetyloxy-7-ethenyl-5-methyldeca-7,9-dienyl)-6-(6,10-dimethyltetradeca-4,10,12-trienoyloxy)-4,7-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | 1-(4-acetyloxy-7-ethenyl-5-methyldeca-7,9-dienyl)-6-(6,10-dimethyltetradeca-4,10,12-trienoyloxy)-4,7-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 123857934 |
| Molecular Formula | C40H56O14 |
| Molecular Weight | 760.87 g/mol |
| Exact Mass | 760.37 |
| IUPAC Name | 1-(4-acetyloxy-7-ethenyl-5-methyldeca-7,9-dienyl)-6-(6,10-dimethyltetradeca-4,10,12-trienoyloxy)-4,7-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | C=CC=C(C=C)CC(C)C(CCCC12OC(C(=O)O)C(O)(C(=O)O)C(C(=O)O)(O1)C(OC(=O)CCC=CC(C)CCCC(C)=CC=CC)C2O)OC(C)=O |
| InChI | InChI=1S/C40H56O14/c1-8-11-17-25(4)19-14-20-26(5)18-12-13-22-31(42)52-33-32(43)38(23-15-21-30(51-28(7)41)27(6)24-29(10-3)16-9-2)53-34(35(44)45)39(50,36(46)47)40(33,54-38)37(48)49/h8-12,16-18,26-27,30,32-34,43,50H,2-3,13-15,19-24H2,1,4-7H3,(H,44,45)(H,46,47)(H,48,49) |
| InChIKey | BJERAFHKNUDNCT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 223.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.87 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|