About 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea
1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea (PubChem CID 123858033) has the molecular formula C22H25N7O
and a molecular weight of 403.49 g/mol. Its IUPAC name is 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea.
Molecular Properties
| Compound Name | 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea |
| PubChem CID | 123858033 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea |
| SMILES | Cc1nc(-c2ccnc(NC(=O)Nc3ccccc3)c2)nc(N2CCNCC2)c1C |
| InChI | InChI=1S/C22H25N7O/c1-15-16(2)25-20(28-21(15)29-12-10-23-11-13-29)17-8-9-24-19(14-17)27-22(30)26-18-6-4-3-5-7-18/h3-9,14,23H,10-13H2,1-2H3,(H2,24,26,27,30) |
| InChIKey | CGXBPRGYILVXQF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea?
The IUPAC name of 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea (CID 123858033) is 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea.
What is the SMILES notation for 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea?
The canonical SMILES for 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea is Cc1nc(-c2ccnc(NC(=O)Nc3ccccc3)c2)nc(N2CCNCC2)c1C.
What is the InChIKey of 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea?
The InChIKey is CGXBPRGYILVXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N7O/c1-15-16(2)25-20(28-21(15)29-12-10-23-11-13-29)17-8-9-24-19(14-17)27-22(30)26-18-6-4-3-5-7-18/h3-9,14,23H,10-13H2,1-2H3,(H2,24,26,27,30).
What are the key properties of 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea?
1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea has a molecular weight of 403.49 g/mol, XLogP of 3.21, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4,5-dimethyl-6-piperazin-1-ylpyrimidin-2-yl)-2-pyridinyl]-3-phenylurea is sourced from PubChem (CID 123858033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).