C28H39F2NO4 — CID 123858670
1-(6-cyclohexyl-12,19-difluoro-11-hydroxy-9,13-dimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-hydroxyethanone (PubChem CID 123858670) has the molecular formula C28H39F2NO4 and a molecular weight of 491.62 g/mol. Its IUPAC name is 1-(6-cyclohexyl-12,19-difluoro-11-hydroxy-9,13-dimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-hydroxyethanone.
| Compound Name | 1-(6-cyclohexyl-12,19-difluoro-11-hydroxy-9,13-dimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-hydroxyethanone |
|---|---|
| PubChem CID | 123858670 |
| Molecular Formula | C28H39F2NO4 |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 1-(6-cyclohexyl-12,19-difluoro-11-hydroxy-9,13-dimethyl-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl)-2-hydroxyethanone |
| SMILES | CC12C=CCC=C1C(F)CC1C3CC4CN(C5CCCCC5)OC4(C(=O)CO)C3(C)CC(O)C12F |
| InChI | InChI=1S/C28H39F2NO4/c1-25-11-7-6-10-19(25)22(29)13-21-20-12-17-15-31(18-8-4-3-5-9-18)35-28(17,24(34)16-32)26(20,2)14-23(33)27(21,25)30/h7,10-11,17-18,20-23,32-33H,3-6,8-9,12-16H2,1-2H3 |
| InChIKey | DVCWCARKIJASKJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|