About 2-fluoro-N'-sulfanylethanimidamide
2-fluoro-N'-sulfanylethanimidamide (PubChem CID 123859636) has the molecular formula C2H5FN2S
and a molecular weight of 108.14 g/mol. Its IUPAC name is 2-fluoro-N'-sulfanylethanimidamide.
Molecular Properties
| Compound Name | 2-fluoro-N'-sulfanylethanimidamide |
| PubChem CID | 123859636 |
| Molecular Formula | C2H5FN2S |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.02 |
| IUPAC Name | 2-fluoro-N'-sulfanylethanimidamide |
| SMILES | NC(CF)=NS |
| InChI | InChI=1S/C2H5FN2S/c3-1-2(4)5-6/h6H,1H2,(H2,4,5) |
| InChIKey | NXYYPAUIXLPRRC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N'-sulfanylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N'-sulfanylethanimidamide?
The IUPAC name of 2-fluoro-N'-sulfanylethanimidamide (CID 123859636) is 2-fluoro-N'-sulfanylethanimidamide.
What is the SMILES notation for 2-fluoro-N'-sulfanylethanimidamide?
The canonical SMILES for 2-fluoro-N'-sulfanylethanimidamide is NC(CF)=NS.
What is the InChIKey of 2-fluoro-N'-sulfanylethanimidamide?
The InChIKey is NXYYPAUIXLPRRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5FN2S/c3-1-2(4)5-6/h6H,1H2,(H2,4,5).
What are the key properties of 2-fluoro-N'-sulfanylethanimidamide?
2-fluoro-N'-sulfanylethanimidamide has a molecular weight of 108.14 g/mol, XLogP of 0.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N'-sulfanylethanimidamide is sourced from PubChem (CID 123859636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).