C28H30F4N6O4 — CID 123859927
tert-butyl N-pyrrolidin-3-yl-N-[2,2,2-trifluoro-1-[3-[6-fluoro-7-(2-hydroxyethoxy)quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]carbamate (PubChem CID 123859927) has the molecular formula C28H30F4N6O4 and a molecular weight of 590.58 g/mol. Its IUPAC name is tert-butyl N-pyrrolidin-3-yl-N-[2,2,2-trifluoro-1-[3-[6-fluoro-7-(2-hydroxyethoxy)quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-pyrrolidin-3-yl-N-[2,2,2-trifluoro-1-[3-[6-fluoro-7-(2-hydroxyethoxy)quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 123859927 |
| Molecular Formula | C28H30F4N6O4 |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | tert-butyl N-pyrrolidin-3-yl-N-[2,2,2-trifluoro-1-[3-[6-fluoro-7-(2-hydroxyethoxy)quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C1CCNC1)C(c1ccc2nnc(-c3ccc4cc(F)c(OCCO)cc4n3)n2c1)C(F)(F)F |
| InChI | InChI=1S/C28H30F4N6O4/c1-27(2,3)42-26(40)38(18-8-9-33-14-18)24(28(30,31)32)17-5-7-23-35-36-25(37(23)15-17)20-6-4-16-12-19(29)22(41-11-10-39)13-21(16)34-20/h4-7,12-13,15,18,24,33,39H,8-11,14H2,1-3H3 |
| InChIKey | KUOMAPGAECUYKD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 114.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |