C22H14ClN3O6 — CID 123859951
(19-ethyl-8-isocyanato-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) carbonochloridate (PubChem CID 123859951) has the molecular formula C22H14ClN3O6 and a molecular weight of 451.82 g/mol. Its IUPAC name is (19-ethyl-8-isocyanato-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) carbonochloridate.
| Compound Name | (19-ethyl-8-isocyanato-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) carbonochloridate |
|---|---|
| PubChem CID | 123859951 |
| Molecular Formula | C22H14ClN3O6 |
| Molecular Weight | 451.82 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | (19-ethyl-8-isocyanato-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) carbonochloridate |
| SMILES | CCC1(OC(=O)Cl)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c(N=C=O)cccc3nc2-1 |
| InChI | InChI=1S/C22H14ClN3O6/c1-2-22(32-21(23)30)14-7-17-18-11(8-26(17)19(28)13(14)9-31-20(22)29)6-12-15(24-10-27)4-3-5-16(12)25-18/h3-7H,2,8-9H2,1H3 |
| InChIKey | QSKGPZDOOMZQCB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 116.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|