C13H16 — CID 123860463
4-methyl-1,2-bis(prop-1-enyl)benzene (PubChem CID 123860463) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 4-methyl-1,2-bis(prop-1-enyl)benzene.
| Compound Name | 4-methyl-1,2-bis(prop-1-enyl)benzene |
|---|---|
| PubChem CID | 123860463 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 4-methyl-1,2-bis(prop-1-enyl)benzene |
| SMILES | CC=Cc1ccc(C)cc1C=CC |
| InChI | InChI=1S/C13H16/c1-4-6-12-9-8-11(3)10-13(12)7-5-2/h4-10H,1-3H3 |
| InChIKey | RCEUYOMQEHADCG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |