C24H40O2 — CID 123860472
2-tert-butyl-5-(1-cyclohexyloxyethoxy)-1-propan-2-yl-2,3,4,5-tetrahydro-1H-indene (PubChem CID 123860472) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is 2-tert-butyl-5-(1-cyclohexyloxyethoxy)-1-propan-2-yl-2,3,4,5-tetrahydro-1H-indene.
| Compound Name | 2-tert-butyl-5-(1-cyclohexyloxyethoxy)-1-propan-2-yl-2,3,4,5-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 123860472 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | 2-tert-butyl-5-(1-cyclohexyloxyethoxy)-1-propan-2-yl-2,3,4,5-tetrahydro-1H-indene |
| SMILES | CC(OC1C=CC2=C(C1)CC(C(C)(C)C)C2C(C)C)OC1CCCCC1 |
| InChI | InChI=1S/C24H40O2/c1-16(2)23-21-13-12-20(14-18(21)15-22(23)24(4,5)6)26-17(3)25-19-10-8-7-9-11-19/h12-13,16-17,19-20,22-23H,7-11,14-15H2,1-6H3 |
| InChIKey | NUPOLMPATASJDD-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|