C22H21Cl2FNO6S- — CID 123860586
2-[2-(carboxymethyl)-5-(4-chloro-3-fluorophenyl)-6-(3-chlorophenyl)-3-oxomorpholin-4-yl]butane-1-sulfinate (PubChem CID 123860586) has the molecular formula C22H21Cl2FNO6S- and a molecular weight of 517.38 g/mol. Its IUPAC name is 2-[2-(carboxymethyl)-5-(4-chloro-3-fluorophenyl)-6-(3-chlorophenyl)-3-oxomorpholin-4-yl]butane-1-sulfinate.
| Compound Name | 2-[2-(carboxymethyl)-5-(4-chloro-3-fluorophenyl)-6-(3-chlorophenyl)-3-oxomorpholin-4-yl]butane-1-sulfinate |
|---|---|
| PubChem CID | 123860586 |
| Molecular Formula | C22H21Cl2FNO6S- |
| Molecular Weight | 517.38 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | 2-[2-(carboxymethyl)-5-(4-chloro-3-fluorophenyl)-6-(3-chlorophenyl)-3-oxomorpholin-4-yl]butane-1-sulfinate |
| SMILES | CCC(CS(=O)[O-])N1C(=O)C(CC(=O)O)OC(c2cccc(Cl)c2)C1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C22H22Cl2FNO6S/c1-2-15(11-33(30)31)26-20(12-6-7-16(24)17(25)9-12)21(13-4-3-5-14(23)8-13)32-18(22(26)29)10-19(27)28/h3-9,15,18,20-21H,2,10-11H2,1H3,(H,27,28)(H,30,31)/p-1 |
| InChIKey | HSXPTWRAOFEMIC-UHFFFAOYSA-M |
| XLogP | 4.27 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|