C23H26F6N4O3S — CID 123860607
8-[2-[4-amino-2,6-bis(trifluoromethyl)phenyl]ethenylsulfonyl]-2-cyclohexyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 123860607) has the molecular formula C23H26F6N4O3S and a molecular weight of 552.54 g/mol. Its IUPAC name is 8-[2-[4-amino-2,6-bis(trifluoromethyl)phenyl]ethenylsulfonyl]-2-cyclohexyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[2-[4-amino-2,6-bis(trifluoromethyl)phenyl]ethenylsulfonyl]-2-cyclohexyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 123860607 |
| Molecular Formula | C23H26F6N4O3S |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | 8-[2-[4-amino-2,6-bis(trifluoromethyl)phenyl]ethenylsulfonyl]-2-cyclohexyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | Nc1cc(C(F)(F)F)c(C=CS(=O)(=O)N2CCC3(CC2)N=C(C2CCCCC2)NC3=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H26F6N4O3S/c24-22(25,26)17-12-15(30)13-18(23(27,28)29)16(17)6-11-37(35,36)33-9-7-21(8-10-33)20(34)31-19(32-21)14-4-2-1-3-5-14/h6,11-14H,1-5,7-10,30H2,(H,31,32,34) |
| InChIKey | SQMGRBIUDVMKBJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|