C19H43N9S — CID 123860731
1-(4-aminobutyl)-3-(4,7,10-trimethyl-3,5,9,11,14,16-hexazabicyclo[5.5.5]heptadecan-1-yl)thiourea (PubChem CID 123860731) has the molecular formula C19H43N9S and a molecular weight of 429.68 g/mol. Its IUPAC name is 1-(4-aminobutyl)-3-(4,7,10-trimethyl-3,5,9,11,14,16-hexazabicyclo[5.5.5]heptadecan-1-yl)thiourea.
| Compound Name | 1-(4-aminobutyl)-3-(4,7,10-trimethyl-3,5,9,11,14,16-hexazabicyclo[5.5.5]heptadecan-1-yl)thiourea |
|---|---|
| PubChem CID | 123860731 |
| Molecular Formula | C19H43N9S |
| Molecular Weight | 429.68 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | 1-(4-aminobutyl)-3-(4,7,10-trimethyl-3,5,9,11,14,16-hexazabicyclo[5.5.5]heptadecan-1-yl)thiourea |
| SMILES | CC1NCC2(C)CNCNCC(NC(=S)NCCCCN)(CN1)CNC(C)NC2 |
| InChI | InChI=1S/C19H43N9S/c1-15-24-9-18(3)8-21-14-22-11-19(12-26-15,13-27-16(2)25-10-18)28-17(29)23-7-5-4-6-20/h15-16,21-22,24-27H,4-14,20H2,1-3H3,(H2,23,28,29) |
| InChIKey | IMAPAKSFPRZMMX-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.68 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|