C26H26F3N3 — CID 123860968
9,9-diethyl-11-(2-methylphenyl)-15-(trifluoromethyl)-1,11,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12(17),13,15-hexaene (PubChem CID 123860968) has the molecular formula C26H26F3N3 and a molecular weight of 437.51 g/mol. Its IUPAC name is 9,9-diethyl-11-(2-methylphenyl)-15-(trifluoromethyl)-1,11,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12(17),13,15-hexaene.
| Compound Name | 9,9-diethyl-11-(2-methylphenyl)-15-(trifluoromethyl)-1,11,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12(17),13,15-hexaene |
|---|---|
| PubChem CID | 123860968 |
| Molecular Formula | C26H26F3N3 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 9,9-diethyl-11-(2-methylphenyl)-15-(trifluoromethyl)-1,11,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12(17),13,15-hexaene |
| SMILES | CCC1(CC)Cc2ccccc2N2c3nc(C(F)(F)F)ccc3N(c3ccccc3C)C21 |
| InChI | InChI=1S/C26H26F3N3/c1-4-25(5-2)16-18-11-7-9-13-20(18)32-23-21(14-15-22(30-23)26(27,28)29)31(24(25)32)19-12-8-6-10-17(19)3/h6-15,24H,4-5,16H2,1-3H3 |
| InChIKey | OXLCIPIAMRBACZ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |