C26H32N6O — CID 123861115
2-(2,4-dimethyl-3,10-diazabicyclo[5.5.0]dodeca-1(12),2,4,10-tetraen-11-yl)-9-methyl-7-(3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 123861115) has the molecular formula C26H32N6O and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-(2,4-dimethyl-3,10-diazabicyclo[5.5.0]dodeca-1(12),2,4,10-tetraen-11-yl)-9-methyl-7-(3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(2,4-dimethyl-3,10-diazabicyclo[5.5.0]dodeca-1(12),2,4,10-tetraen-11-yl)-9-methyl-7-(3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 123861115 |
| Molecular Formula | C26H32N6O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 2-(2,4-dimethyl-3,10-diazabicyclo[5.5.0]dodeca-1(12),2,4,10-tetraen-11-yl)-9-methyl-7-(3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC1=CCC2CCN=C(c3cc(=O)n4cc(N5CCNC(C)C5)cc(C)c4n3)C=C2C(C)=N1 |
| InChI | InChI=1S/C26H32N6O/c1-16-11-21(31-10-9-27-18(3)14-31)15-32-25(33)13-24(30-26(16)32)23-12-22-19(4)29-17(2)5-6-20(22)7-8-28-23/h5,11-13,15,18,20,27H,6-10,14H2,1-4H3 |
| InChIKey | LXDONNCVLMLUND-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 74.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |