About (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine
(4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine (PubChem CID 123861223) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine.
Molecular Properties
| Compound Name | (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine |
| PubChem CID | 123861223 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine |
| SMILES | COC1=CC(C)=NCC1CN |
| InChI | InChI=1S/C8H14N2O/c1-6-3-8(11-2)7(4-9)5-10-6/h3,7H,4-5,9H2,1-2H3 |
| InChIKey | XUNQGPPLWPHMIS-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine?
The IUPAC name of (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine (CID 123861223) is (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine.
What is the SMILES notation for (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine?
The canonical SMILES for (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine is COC1=CC(C)=NCC1CN.
What is the InChIKey of (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine?
The InChIKey is XUNQGPPLWPHMIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-6-3-8(11-2)7(4-9)5-10-6/h3,7H,4-5,9H2,1-2H3.
What are the key properties of (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine?
(4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine has a molecular weight of 154.21 g/mol, XLogP of 0.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-6-methyl-2,3-dihydropyridin-3-yl)methanamine is sourced from PubChem (CID 123861223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).