About 4-ethyl-1,4-diazabicyclo[4.2.2]decane
4-ethyl-1,4-diazabicyclo[4.2.2]decane (PubChem CID 123861450) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 4-ethyl-1,4-diazabicyclo[4.2.2]decane.
Molecular Properties
| Compound Name | 4-ethyl-1,4-diazabicyclo[4.2.2]decane |
| PubChem CID | 123861450 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 4-ethyl-1,4-diazabicyclo[4.2.2]decane |
| SMILES | CCN1CCN2CCC(CC2)C1 |
| InChI | InChI=1S/C10H20N2/c1-2-11-7-8-12-5-3-10(9-11)4-6-12/h10H,2-9H2,1H3 |
| InChIKey | XXJVJIUEDNNOKP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-1,4-diazabicyclo[4.2.2]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,4-diazabicyclo[4.2.2]decane?
The IUPAC name of 4-ethyl-1,4-diazabicyclo[4.2.2]decane (CID 123861450) is 4-ethyl-1,4-diazabicyclo[4.2.2]decane.
What is the SMILES notation for 4-ethyl-1,4-diazabicyclo[4.2.2]decane?
The canonical SMILES for 4-ethyl-1,4-diazabicyclo[4.2.2]decane is CCN1CCN2CCC(CC2)C1.
What is the InChIKey of 4-ethyl-1,4-diazabicyclo[4.2.2]decane?
The InChIKey is XXJVJIUEDNNOKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-2-11-7-8-12-5-3-10(9-11)4-6-12/h10H,2-9H2,1H3.
What are the key properties of 4-ethyl-1,4-diazabicyclo[4.2.2]decane?
4-ethyl-1,4-diazabicyclo[4.2.2]decane has a molecular weight of 168.28 g/mol, XLogP of 1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,4-diazabicyclo[4.2.2]decane is sourced from PubChem (CID 123861450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).