C15H16F4O3S — CID 123861541
4-(3-ethylidene-2-methylhex-4-en-2-yl)-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 123861541) has the molecular formula C15H16F4O3S and a molecular weight of 352.35 g/mol. Its IUPAC name is 4-(3-ethylidene-2-methylhex-4-en-2-yl)-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-(3-ethylidene-2-methylhex-4-en-2-yl)-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 123861541 |
| Molecular Formula | C15H16F4O3S |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 4-(3-ethylidene-2-methylhex-4-en-2-yl)-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CC=CC(=CC)C(C)(C)c1c(F)c(F)c(S(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C15H16F4O3S/c1-5-7-8(6-2)15(3,4)9-10(16)12(18)14(23(20,21)22)13(19)11(9)17/h5-7H,1-4H3,(H,20,21,22) |
| InChIKey | NIKKRMLIENTVSU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|