C58H72N2O4 — CID 123862254
N-[1,2-bis(2,4-dimethylphenoxy)ethyl]-2-[2-[2-(2,4-dimethylanilino)-1-(2,4-dimethylphenoxy)ethoxy]-5,6-dimethyl-3-propan-2-ylphenyl]-3,4-dimethyl-6-propan-2-ylaniline (PubChem CID 123862254) has the molecular formula C58H72N2O4 and a molecular weight of 861.22 g/mol. Its IUPAC name is N-[1,2-bis(2,4-dimethylphenoxy)ethyl]-2-[2-[2-(2,4-dimethylanilino)-1-(2,4-dimethylphenoxy)ethoxy]-5,6-dimethyl-3-propan-2-ylphenyl]-3,4-dimethyl-6-propan-2-ylaniline.
| Compound Name | N-[1,2-bis(2,4-dimethylphenoxy)ethyl]-2-[2-[2-(2,4-dimethylanilino)-1-(2,4-dimethylphenoxy)ethoxy]-5,6-dimethyl-3-propan-2-ylphenyl]-3,4-dimethyl-6-propan-2-ylaniline |
|---|---|
| PubChem CID | 123862254 |
| Molecular Formula | C58H72N2O4 |
| Molecular Weight | 861.22 g/mol |
| Exact Mass | 860.55 |
| IUPAC Name | N-[1,2-bis(2,4-dimethylphenoxy)ethyl]-2-[2-[2-(2,4-dimethylanilino)-1-(2,4-dimethylphenoxy)ethoxy]-5,6-dimethyl-3-propan-2-ylphenyl]-3,4-dimethyl-6-propan-2-ylaniline |
| SMILES | Cc1ccc(NCC(Oc2ccc(C)cc2C)Oc2c(C(C)C)cc(C)c(C)c2-c2c(C)c(C)cc(C(C)C)c2NC(COc2ccc(C)cc2C)Oc2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C58H72N2O4/c1-33(2)47-29-39(9)45(15)55(57(47)60-53(62-51-23-19-37(7)27-43(51)13)32-61-50-22-18-36(6)26-42(50)12)56-46(16)40(10)30-48(34(3)4)58(56)64-54(63-52-24-20-38(8)28-44(52)14)31-59-49-21-17-35(5)25-41(49)11/h17-30,33-34,53-54,59-60H,31-32H2,1-16H3 |
| InChIKey | QQXGCHGDJLNBCQ-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.22 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|