C20H17FN2O — CID 123862324
6-fluoro-5-[4-[1-(methylideneamino)penta-1,3-dien-3-yl]phenyl]-1,3-dihydroindol-2-one (PubChem CID 123862324) has the molecular formula C20H17FN2O and a molecular weight of 320.37 g/mol. Its IUPAC name is 6-fluoro-5-[4-[1-(methylideneamino)penta-1,3-dien-3-yl]phenyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-fluoro-5-[4-[1-(methylideneamino)penta-1,3-dien-3-yl]phenyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 123862324 |
| Molecular Formula | C20H17FN2O |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 6-fluoro-5-[4-[1-(methylideneamino)penta-1,3-dien-3-yl]phenyl]-1,3-dihydroindol-2-one |
| SMILES | C=NC=CC(=CC)c1ccc(-c2cc3c(cc2F)NC(=O)C3)cc1 |
| InChI | InChI=1S/C20H17FN2O/c1-3-13(8-9-22-2)14-4-6-15(7-5-14)17-10-16-11-20(24)23-19(16)12-18(17)21/h3-10,12H,2,11H2,1H3,(H,23,24) |
| InChIKey | OTJDCTXQOKBKMU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|