C22H22FN5O2 — CID 123862457
7-(3,4-dimethylpiperazin-1-yl)-5-fluoro-3-(6-methylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one (PubChem CID 123862457) has the molecular formula C22H22FN5O2 and a molecular weight of 407.45 g/mol. Its IUPAC name is 7-(3,4-dimethylpiperazin-1-yl)-5-fluoro-3-(6-methylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one.
| Compound Name | 7-(3,4-dimethylpiperazin-1-yl)-5-fluoro-3-(6-methylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 123862457 |
| Molecular Formula | C22H22FN5O2 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 7-(3,4-dimethylpiperazin-1-yl)-5-fluoro-3-(6-methylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one |
| SMILES | Cc1cn2cc(-c3cc4c(F)cc(N5CCN(C)C(C)C5)cc4oc3=O)nc2cn1 |
| InChI | InChI=1S/C22H22FN5O2/c1-13-10-28-12-19(25-21(28)9-24-13)17-8-16-18(23)6-15(7-20(16)30-22(17)29)27-5-4-26(3)14(2)11-27/h6-10,12,14H,4-5,11H2,1-3H3 |
| InChIKey | QEDWELKSJXTXOT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|