C12H24N2 — CID 123862547
2-methyl-N'-propan-2-yloct-4-enimidamide (PubChem CID 123862547) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 2-methyl-N'-propan-2-yloct-4-enimidamide.
| Compound Name | 2-methyl-N'-propan-2-yloct-4-enimidamide |
|---|---|
| PubChem CID | 123862547 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 2-methyl-N'-propan-2-yloct-4-enimidamide |
| SMILES | CCCC=CCC(C)/C(N)=N/C(C)C |
| InChI | InChI=1S/C12H24N2/c1-5-6-7-8-9-11(4)12(13)14-10(2)3/h7-8,10-11H,5-6,9H2,1-4H3,(H2,13,14) |
| InChIKey | LJAKJVDTBMFHFX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|