C22H16Cl4F4N2O3 — CID 123862604
1,3-bis[3-(3,4-dichlorophenyl)-3,3-difluoropropyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 123862604) has the molecular formula C22H16Cl4F4N2O3 and a molecular weight of 574.19 g/mol. Its IUPAC name is 1,3-bis[3-(3,4-dichlorophenyl)-3,3-difluoropropyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1,3-bis[3-(3,4-dichlorophenyl)-3,3-difluoropropyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123862604 |
| Molecular Formula | C22H16Cl4F4N2O3 |
| Molecular Weight | 574.19 g/mol |
| Exact Mass | 571.99 |
| IUPAC Name | 1,3-bis[3-(3,4-dichlorophenyl)-3,3-difluoropropyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | O=c1cc(O)n(CCC(F)(F)c2ccc(Cl)c(Cl)c2)c(=O)n1CCC(F)(F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H16Cl4F4N2O3/c23-14-3-1-12(9-16(14)25)21(27,28)5-7-31-18(33)11-19(34)32(20(31)35)8-6-22(29,30)13-2-4-15(24)17(26)10-13/h1-4,9-11,33H,5-8H2 |
| InChIKey | PRPQHXNPGSSHBO-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.19 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |