C31H52O6Si5 — CID 123863177
2,4,6,8,10-pentamethyl-8-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-2,4-bis(2-phenylpropyl)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 123863177) has the molecular formula C31H52O6Si5 and a molecular weight of 661.18 g/mol. Its IUPAC name is 2,4,6,8,10-pentamethyl-8-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-2,4-bis(2-phenylpropyl)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,4,6,8,10-pentamethyl-8-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-2,4-bis(2-phenylpropyl)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 123863177 |
| Molecular Formula | C31H52O6Si5 |
| Molecular Weight | 661.18 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | 2,4,6,8,10-pentamethyl-8-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-2,4-bis(2-phenylpropyl)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CC(C[Si]1(C)O[SiH](C)O[Si](C)(CCC2CCC3OC3C2)O[SiH](C)O[Si](C)(CC(C)c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C31H52O6Si5/c1-25(28-14-10-8-11-15-28)23-41(6)35-38(3)33-40(5,21-20-27-18-19-30-31(22-27)32-30)34-39(4)36-42(7,37-41)24-26(2)29-16-12-9-13-17-29/h8-17,25-27,30-31,38-39H,18-24H2,1-7H3 |
| InChIKey | UCWOWGXWDUVEFP-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.18 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|