C21H25ClFN5O3 — CID 123863387
[[(E)-1-amino-4-chloro-2-ethyliminopent-3-enylidene]amino] 5-fluoro-2-oxo-1,6-diazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-14-carboxylate (PubChem CID 123863387) has the molecular formula C21H25ClFN5O3 and a molecular weight of 449.91 g/mol. Its IUPAC name is [[(E)-1-amino-4-chloro-2-ethyliminopent-3-enylidene]amino] 5-fluoro-2-oxo-1,6-diazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-14-carboxylate.
| Compound Name | [[(E)-1-amino-4-chloro-2-ethyliminopent-3-enylidene]amino] 5-fluoro-2-oxo-1,6-diazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-14-carboxylate |
|---|---|
| PubChem CID | 123863387 |
| Molecular Formula | C21H25ClFN5O3 |
| Molecular Weight | 449.91 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | [[(E)-1-amino-4-chloro-2-ethyliminopent-3-enylidene]amino] 5-fluoro-2-oxo-1,6-diazatricyclo[9.4.0.03,8]pentadeca-3,5,7-triene-14-carboxylate |
| SMILES | CC/N=C(\C=C(/C)Cl)C(N)=NOC(=O)C1CCC2CCc3cnc(F)cc3C(=O)N2C1 |
| InChI | InChI=1S/C21H25ClFN5O3/c1-3-25-17(8-12(2)22)19(24)27-31-21(30)14-5-7-15-6-4-13-10-26-18(23)9-16(13)20(29)28(15)11-14/h8-10,14-15H,3-7,11H2,1-2H3,(H2,24,27)/b12-8+,25-17+ |
| InChIKey | ASVOSGITFGVTMQ-RGXLAROMSA-N |
| XLogP | 2.81 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.91 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|