C22H27N3O4 — CID 123863546
[amino-[2-[3-carbamoyl-4-(cyclopropylmethoxy)phenyl]-3-pyridinyl]methyl] 3-methylbutanoate (PubChem CID 123863546) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is [amino-[2-[3-carbamoyl-4-(cyclopropylmethoxy)phenyl]-3-pyridinyl]methyl] 3-methylbutanoate.
| Compound Name | [amino-[2-[3-carbamoyl-4-(cyclopropylmethoxy)phenyl]-3-pyridinyl]methyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 123863546 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [amino-[2-[3-carbamoyl-4-(cyclopropylmethoxy)phenyl]-3-pyridinyl]methyl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OC(N)c1cccnc1-c1ccc(OCC2CC2)c(C(N)=O)c1 |
| InChI | InChI=1S/C22H27N3O4/c1-13(2)10-19(26)29-22(24)16-4-3-9-25-20(16)15-7-8-18(17(11-15)21(23)27)28-12-14-5-6-14/h3-4,7-9,11,13-14,22H,5-6,10,12,24H2,1-2H3,(H2,23,27) |
| InChIKey | ZQZKUUDNVJXXJU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|