C10H14O3 — CID 123863605
5-hydroxy-2-methyl-2,3,4,5-tetrahydrooxecin-10-one (PubChem CID 123863605) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-2,3,4,5-tetrahydrooxecin-10-one.
| Compound Name | 5-hydroxy-2-methyl-2,3,4,5-tetrahydrooxecin-10-one |
|---|---|
| PubChem CID | 123863605 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 5-hydroxy-2-methyl-2,3,4,5-tetrahydrooxecin-10-one |
| SMILES | CC1CCC(O)C=CC=CC(=O)O1 |
| InChI | InChI=1S/C10H14O3/c1-8-6-7-9(11)4-2-3-5-10(12)13-8/h2-5,8-9,11H,6-7H2,1H3 |
| InChIKey | SEURXENDYJJSDO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |