C19H24F3N5O3S — CID 123863621
1-[2-[4-(aminooxyamino)-3-[3-(morpholin-4-ylmethyl)azetidin-1-yl]phenyl]-1,3-thiazol-4-yl]-2,2,2-trifluoroethanol (PubChem CID 123863621) has the molecular formula C19H24F3N5O3S and a molecular weight of 459.49 g/mol. Its IUPAC name is 1-[2-[4-(aminooxyamino)-3-[3-(morpholin-4-ylmethyl)azetidin-1-yl]phenyl]-1,3-thiazol-4-yl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[2-[4-(aminooxyamino)-3-[3-(morpholin-4-ylmethyl)azetidin-1-yl]phenyl]-1,3-thiazol-4-yl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 123863621 |
| Molecular Formula | C19H24F3N5O3S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 1-[2-[4-(aminooxyamino)-3-[3-(morpholin-4-ylmethyl)azetidin-1-yl]phenyl]-1,3-thiazol-4-yl]-2,2,2-trifluoroethanol |
| SMILES | NONc1ccc(-c2nc(C(O)C(F)(F)F)cs2)cc1N1CC(CN2CCOCC2)C1 |
| InChI | InChI=1S/C19H24F3N5O3S/c20-19(21,22)17(28)15-11-31-18(24-15)13-1-2-14(25-30-23)16(7-13)27-9-12(10-27)8-26-3-5-29-6-4-26/h1-2,7,11-12,17,25,28H,3-6,8-10,23H2 |
| InChIKey | JXIDXRMXSFDMJO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|