About 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide
2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide (PubChem CID 123863918) has the molecular formula C9H12F3NO
and a molecular weight of 207.19 g/mol. Its IUPAC name is 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide.
Molecular Properties
| Compound Name | 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide |
| PubChem CID | 123863918 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide |
| SMILES | C=CC(=CC)C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C9H12F3NO/c1-3-7(4-2)8(14)13-6-5-9(10,11)12/h3-4H,1,5-6H2,2H3,(H,13,14) |
| InChIKey | ISROISZAVDDUQA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide?
The IUPAC name of 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide (CID 123863918) is 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide.
What is the SMILES notation for 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide?
The canonical SMILES for 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide is C=CC(=CC)C(=O)NCCC(F)(F)F.
What is the InChIKey of 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide?
The InChIKey is ISROISZAVDDUQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO/c1-3-7(4-2)8(14)13-6-5-9(10,11)12/h3-4H,1,5-6H2,2H3,(H,13,14).
What are the key properties of 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide?
2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide has a molecular weight of 207.19 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-N-(3,3,3-trifluoropropyl)but-2-enamide is sourced from PubChem (CID 123863918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).