About diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate
diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate (PubChem CID 123864017) has the molecular formula C17H15BrO4S2
and a molecular weight of 427.34 g/mol. Its IUPAC name is diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate |
| PubChem CID | 123864017 |
| Molecular Formula | C17H15BrO4S2 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc2c(Br)c3sc(C(=O)OCC)cc3c(C)c2s1 |
| InChI | InChI=1S/C17H15BrO4S2/c1-4-21-16(19)11-6-9-8(3)14-10(13(18)15(9)24-11)7-12(23-14)17(20)22-5-2/h6-7H,4-5H2,1-3H3 |
| InChIKey | WIASFEVEIWISIQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate?
The IUPAC name of diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate (CID 123864017) is diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate.
What is the SMILES notation for diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate?
The canonical SMILES for diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate is CCOC(=O)c1cc2c(Br)c3sc(C(=O)OCC)cc3c(C)c2s1.
What is the InChIKey of diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate?
The InChIKey is WIASFEVEIWISIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrO4S2/c1-4-21-16(19)11-6-9-8(3)14-10(13(18)15(9)24-11)7-12(23-14)17(20)22-5-2/h6-7H,4-5H2,1-3H3.
What are the key properties of diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate?
diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate has a molecular weight of 427.34 g/mol, XLogP of 5.54, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-bromo-8-methylthieno[2,3-f][1]benzothiole-2,6-dicarboxylate is sourced from PubChem (CID 123864017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).