C26H24F2N2O2+2 — CID 123864105
methyl 1-[(2,4-diethyl-7,9-difluoro-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5(10),6,8,11,13-hexaen-3-ylidene)methyl]pyridin-1-ium-2-carboxylate (PubChem CID 123864105) has the molecular formula C26H24F2N2O2+2 and a molecular weight of 434.49 g/mol. Its IUPAC name is methyl 1-[(2,4-diethyl-7,9-difluoro-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5(10),6,8,11,13-hexaen-3-ylidene)methyl]pyridin-1-ium-2-carboxylate.
| Compound Name | methyl 1-[(2,4-diethyl-7,9-difluoro-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5(10),6,8,11,13-hexaen-3-ylidene)methyl]pyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 123864105 |
| Molecular Formula | C26H24F2N2O2+2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | methyl 1-[(2,4-diethyl-7,9-difluoro-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5(10),6,8,11,13-hexaen-3-ylidene)methyl]pyridin-1-ium-2-carboxylate |
| SMILES | CCC12C(=C[n+]3ccccc3C(=O)OC)C1(CC)[n+]1ccccc1-c1c(F)cc(F)cc12 |
| InChI | InChI=1S/C26H24F2N2O2/c1-4-25-18-14-17(27)15-19(28)23(18)20-10-7-9-13-30(20)26(25,5-2)22(25)16-29-12-8-6-11-21(29)24(31)32-3/h6-16H,4-5H2,1-3H3/q+2 |
| InChIKey | OIOGWHNUAPPCEH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|