C8H14N3O+ — CID 123864326
4-(2-methoxyethenyl)-1,2-dimethylpyrazol-2-ium-5-amine (PubChem CID 123864326) has the molecular formula C8H14N3O+ and a molecular weight of 168.22 g/mol. Its IUPAC name is 4-(2-methoxyethenyl)-1,2-dimethylpyrazol-2-ium-5-amine.
| Compound Name | 4-(2-methoxyethenyl)-1,2-dimethylpyrazol-2-ium-5-amine |
|---|---|
| PubChem CID | 123864326 |
| Molecular Formula | C8H14N3O+ |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 4-(2-methoxyethenyl)-1,2-dimethylpyrazol-2-ium-5-amine |
| SMILES | COC=Cc1c[n+](C)n(C)c1N |
| InChI | InChI=1S/C8H13N3O/c1-10-6-7(4-5-12-3)8(9)11(10)2/h4-6,9H,1-3H3/p+1 |
| InChIKey | QEJCYQSTJRNNDY-UHFFFAOYSA-O |
| XLogP | 0.05 |
| TPSA | 44.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|