C15H24O3Si2 — CID 123864675
(5S)-7,9-bis(trimethylsilyl)-1-oxaspiro[4.5]deca-7,9-diene-2,6-dione (PubChem CID 123864675) has the molecular formula C15H24O3Si2 and a molecular weight of 308.53 g/mol. Its IUPAC name is (5S)-7,9-bis(trimethylsilyl)-1-oxaspiro[4.5]deca-7,9-diene-2,6-dione.
| Compound Name | (5S)-7,9-bis(trimethylsilyl)-1-oxaspiro[4.5]deca-7,9-diene-2,6-dione |
|---|---|
| PubChem CID | 123864675 |
| Molecular Formula | C15H24O3Si2 |
| Molecular Weight | 308.53 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (5S)-7,9-bis(trimethylsilyl)-1-oxaspiro[4.5]deca-7,9-diene-2,6-dione |
| SMILES | C[Si](C)(C)C1=C[C@@]2(CCC(=O)O2)C(=O)C([Si](C)(C)C)=C1 |
| InChI | InChI=1S/C15H24O3Si2/c1-19(2,3)11-9-12(20(4,5)6)14(17)15(10-11)8-7-13(16)18-15/h9-10H,7-8H2,1-6H3/t15-/m0/s1 |
| InChIKey | PXVONHMXDQKSHX-HNNXBMFYSA-N |
| XLogP | 3.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|