C8H13N3 — CID 123864882
2-N-methyl-3,4,5,6-tetrahydroazocine-2,7-diimine (PubChem CID 123864882) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-N-methyl-3,4,5,6-tetrahydroazocine-2,7-diimine.
| Compound Name | 2-N-methyl-3,4,5,6-tetrahydroazocine-2,7-diimine |
|---|---|
| PubChem CID | 123864882 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 2-N-methyl-3,4,5,6-tetrahydroazocine-2,7-diimine |
| SMILES | [H]/N=C1/C=N\C(=N\C)CCCC1 |
| InChI | InChI=1S/C8H13N3/c1-10-8-5-3-2-4-7(9)6-11-8/h6,9H,2-5H2,1H3/b9-7+,10-8+,11-6- |
| InChIKey | GSOZNFIWGUMYKY-UPPVFMATSA-N |
| XLogP | 1.68 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|