C22H30F3NO — CID 123865430
N-[6,7-dimethyl-4-[2-(trifluoromethyl)-3,3a,4,5,6,6a-hexahydropentalen-1-yl]cyclohepta-2,4-dien-1-yl]-2-methylpropanamide (PubChem CID 123865430) has the molecular formula C22H30F3NO and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[6,7-dimethyl-4-[2-(trifluoromethyl)-3,3a,4,5,6,6a-hexahydropentalen-1-yl]cyclohepta-2,4-dien-1-yl]-2-methylpropanamide.
| Compound Name | N-[6,7-dimethyl-4-[2-(trifluoromethyl)-3,3a,4,5,6,6a-hexahydropentalen-1-yl]cyclohepta-2,4-dien-1-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 123865430 |
| Molecular Formula | C22H30F3NO |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | N-[6,7-dimethyl-4-[2-(trifluoromethyl)-3,3a,4,5,6,6a-hexahydropentalen-1-yl]cyclohepta-2,4-dien-1-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC1C=CC(C2=C(C(F)(F)F)CC3CCCC23)=CC(C)C1C |
| InChI | InChI=1S/C22H30F3NO/c1-12(2)21(27)26-19-9-8-16(10-13(3)14(19)4)20-17-7-5-6-15(17)11-18(20)22(23,24)25/h8-10,12-15,17,19H,5-7,11H2,1-4H3,(H,26,27) |
| InChIKey | APZXFZMRTKPWFN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |