About N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide
N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide (PubChem CID 123865959) has the molecular formula C10H20NO6P
and a molecular weight of 281.24 g/mol. Its IUPAC name is N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide |
| PubChem CID | 123865959 |
| Molecular Formula | C10H20NO6P |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide |
| SMILES | CCCC(O)C(COP1(=O)OCCO1)NC(C)=O |
| InChI | InChI=1S/C10H20NO6P/c1-3-4-10(13)9(11-8(2)12)7-17-18(14)15-5-6-16-18/h9-10,13H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | RUAMQHCLIADHOL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide?
The IUPAC name of N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide (CID 123865959) is N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide.
What is the SMILES notation for N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide?
The canonical SMILES for N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide is CCCC(O)C(COP1(=O)OCCO1)NC(C)=O.
What is the InChIKey of N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide?
The InChIKey is RUAMQHCLIADHOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20NO6P/c1-3-4-10(13)9(11-8(2)12)7-17-18(14)15-5-6-16-18/h9-10,13H,3-7H2,1-2H3,(H,11,12).
What are the key properties of N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide?
N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide has a molecular weight of 281.24 g/mol, XLogP of 0.82, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-hydroxy-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]hexan-2-yl]acetamide is sourced from PubChem (CID 123865959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).