About tris(but-2-ynoxy)silane
tris(but-2-ynoxy)silane (PubChem CID 123866468) has the molecular formula C12H16O3Si
and a molecular weight of 236.34 g/mol. Its IUPAC name is tris(but-2-ynoxy)silane.
Molecular Properties
| Compound Name | tris(but-2-ynoxy)silane |
| PubChem CID | 123866468 |
| Molecular Formula | C12H16O3Si |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | tris(but-2-ynoxy)silane |
| SMILES | CC#CCO[SiH](OCC#CC)OCC#CC |
| InChI | InChI=1S/C12H16O3Si/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h16H,10-12H2,1-3H3 |
| InChIKey | JLDIKAMQIISHGM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tris(but-2-ynoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(but-2-ynoxy)silane?
The IUPAC name of tris(but-2-ynoxy)silane (CID 123866468) is tris(but-2-ynoxy)silane.
What is the SMILES notation for tris(but-2-ynoxy)silane?
The canonical SMILES for tris(but-2-ynoxy)silane is CC#CCO[SiH](OCC#CC)OCC#CC.
What is the InChIKey of tris(but-2-ynoxy)silane?
The InChIKey is JLDIKAMQIISHGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3Si/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h16H,10-12H2,1-3H3.
What are the key properties of tris(but-2-ynoxy)silane?
tris(but-2-ynoxy)silane has a molecular weight of 236.34 g/mol, XLogP of 0.82, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris(but-2-ynoxy)silane is sourced from PubChem (CID 123866468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).