C9H12FN — CID 123866645
6-fluoro-2-methyl-2,3,3a,7a-tetrahydro-1H-indole (PubChem CID 123866645) has the molecular formula C9H12FN and a molecular weight of 153.20 g/mol. Its IUPAC name is 6-fluoro-2-methyl-2,3,3a,7a-tetrahydro-1H-indole.
| Compound Name | 6-fluoro-2-methyl-2,3,3a,7a-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 123866645 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 6-fluoro-2-methyl-2,3,3a,7a-tetrahydro-1H-indole |
| SMILES | CC1CC2C=CC(F)=CC2N1 |
| InChI | InChI=1S/C9H12FN/c1-6-4-7-2-3-8(10)5-9(7)11-6/h2-3,5-7,9,11H,4H2,1H3 |
| InChIKey | AZWRSCNKAWTTKV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |