C62H50O6 — CID 123866797
4-[4-[3,5-bis[4-(4-carboxyphenyl)phenyl]-7-[4-(4-methylphenyl)phenyl]-1-adamantyl]phenyl]benzoic acid (PubChem CID 123866797) has the molecular formula C62H50O6 and a molecular weight of 891.08 g/mol. Its IUPAC name is 4-[4-[3,5-bis[4-(4-carboxyphenyl)phenyl]-7-[4-(4-methylphenyl)phenyl]-1-adamantyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[3,5-bis[4-(4-carboxyphenyl)phenyl]-7-[4-(4-methylphenyl)phenyl]-1-adamantyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 123866797 |
| Molecular Formula | C62H50O6 |
| Molecular Weight | 891.08 g/mol |
| Exact Mass | 890.36 |
| IUPAC Name | 4-[4-[3,5-bis[4-(4-carboxyphenyl)phenyl]-7-[4-(4-methylphenyl)phenyl]-1-adamantyl]phenyl]benzoic acid |
| SMILES | Cc1ccc(-c2ccc(C34CC5(c6ccc(-c7ccc(C(=O)O)cc7)cc6)CC(c6ccc(-c7ccc(C(=O)O)cc7)cc6)(C3)CC(c3ccc(-c6ccc(C(=O)O)cc6)cc3)(C4)C5)cc2)cc1 |
| InChI | InChI=1S/C62H50O6/c1-40-2-4-41(5-3-40)45-18-26-52(27-19-45)59-34-60(53-28-20-46(21-29-53)42-6-12-49(13-7-42)56(63)64)37-61(35-59,54-30-22-47(23-31-54)43-8-14-50(15-9-43)57(65)66)39-62(36-59,38-60)55-32-24-48(25-33-55)44-10-16-51(17-11-44)58(67)68/h2-33H,34-39H2,1H3,(H,63,64)(H,65,66)(H,67,68) |
| InChIKey | CTILNPLZBLBCGG-UHFFFAOYSA-N |
| XLogP | 14.19 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.08 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |