C11H9ClF3N3O2 — CID 123867893
4-[(6-chloro-3-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]-3H-1,3-oxazol-2-one (PubChem CID 123867893) has the molecular formula C11H9ClF3N3O2 and a molecular weight of 307.66 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]-3H-1,3-oxazol-2-one.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]-3H-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 123867893 |
| Molecular Formula | C11H9ClF3N3O2 |
| Molecular Weight | 307.66 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]-3H-1,3-oxazol-2-one |
| SMILES | O=c1[nH]c(N(Cc2ccc(Cl)nc2)CC(F)(F)F)co1 |
| InChI | InChI=1S/C11H9ClF3N3O2/c12-8-2-1-7(3-16-8)4-18(6-11(13,14)15)9-5-20-10(19)17-9/h1-3,5H,4,6H2,(H,17,19) |
| InChIKey | DYRCOOQWLRPMLU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.66 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|