About 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene
1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene (PubChem CID 123868273) has the molecular formula C18H30
and a molecular weight of 246.44 g/mol. Its IUPAC name is 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene |
| PubChem CID | 123868273 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene |
| SMILES | CCCC1(CCC)CC(C(C)C2=CC=C(C)C2)C1 |
| InChI | InChI=1S/C18H30/c1-5-9-18(10-6-2)12-17(13-18)15(4)16-8-7-14(3)11-16/h7-8,15,17H,5-6,9-13H2,1-4H3 |
| InChIKey | RIFWHQIHEYVWAI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene?
The IUPAC name of 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene (CID 123868273) is 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene.
What is the SMILES notation for 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene?
The canonical SMILES for 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene is CCCC1(CCC)CC(C(C)C2=CC=C(C)C2)C1.
What is the InChIKey of 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene?
The InChIKey is RIFWHQIHEYVWAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30/c1-5-9-18(10-6-2)12-17(13-18)15(4)16-8-7-14(3)11-16/h7-8,15,17H,5-6,9-13H2,1-4H3.
What are the key properties of 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene?
1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene has a molecular weight of 246.44 g/mol, XLogP of 5.90, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,3-dipropylcyclobutyl)ethyl]-4-methylcyclopenta-1,3-diene is sourced from PubChem (CID 123868273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).