C14H17N — CID 123868508
N-[1-(4-methylcyclohexa-1,5-dien-1-yl)buta-1,3-dienyl]prop-2-en-1-imine (PubChem CID 123868508) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is N-[1-(4-methylcyclohexa-1,5-dien-1-yl)buta-1,3-dienyl]prop-2-en-1-imine.
| Compound Name | N-[1-(4-methylcyclohexa-1,5-dien-1-yl)buta-1,3-dienyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 123868508 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-[1-(4-methylcyclohexa-1,5-dien-1-yl)buta-1,3-dienyl]prop-2-en-1-imine |
| SMILES | C=CC=C(/N=C/C=C)C1=CCC(C)C=C1 |
| InChI | InChI=1S/C14H17N/c1-4-6-14(15-11-5-2)13-9-7-12(3)8-10-13/h4-7,9-12H,1-2,8H2,3H3/b14-6?,15-11+ |
| InChIKey | UJHMCLPJWSUKTJ-JEMPHUQRSA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|