C29H31N2+ — CID 123868813
7,9,9-trimethyl-8-[1-methyl-7-(2-methylpropyl)quinolin-1-ium-2-yl]indeno[2,1-b]pyridine (PubChem CID 123868813) has the molecular formula C29H31N2+ and a molecular weight of 407.58 g/mol. Its IUPAC name is 7,9,9-trimethyl-8-[1-methyl-7-(2-methylpropyl)quinolin-1-ium-2-yl]indeno[2,1-b]pyridine.
| Compound Name | 7,9,9-trimethyl-8-[1-methyl-7-(2-methylpropyl)quinolin-1-ium-2-yl]indeno[2,1-b]pyridine |
|---|---|
| PubChem CID | 123868813 |
| Molecular Formula | C29H31N2+ |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 7,9,9-trimethyl-8-[1-methyl-7-(2-methylpropyl)quinolin-1-ium-2-yl]indeno[2,1-b]pyridine |
| SMILES | Cc1ccc2c(c1-c1ccc3ccc(CC(C)C)cc3[n+]1C)C(C)(C)c1ncccc1-2 |
| InChI | InChI=1S/C29H31N2/c1-18(2)16-20-10-11-21-12-14-24(31(6)25(21)17-20)26-19(3)9-13-22-23-8-7-15-30-28(23)29(4,5)27(22)26/h7-15,17-18H,16H2,1-6H3/q+1 |
| InChIKey | SBXKGEZTBFSBKX-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|